About [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate
[4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate (PubChem CID 58790827) has the molecular formula C18H15NO3S2
and a molecular weight of 357.46 g/mol. Its IUPAC name is [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate.
Molecular Properties
| Compound Name | [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate |
| PubChem CID | 58790827 |
| Molecular Formula | C18H15NO3S2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate |
| SMILES | Nc1ccc(OS(=O)(=O)c2cccs2)cc1/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H15NO3S2/c19-17-11-10-16(22-24(20,21)18-7-4-12-23-18)13-15(17)9-8-14-5-2-1-3-6-14/h1-13H,19H2/b9-8+ |
| InChIKey | CKXXKQOFOSIVMS-CMDGGOBGSA-N |
| XLogP | 4.27 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate?
The IUPAC name of [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate (CID 58790827) is [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate.
What is the SMILES notation for [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate?
The canonical SMILES for [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate is Nc1ccc(OS(=O)(=O)c2cccs2)cc1/C=C/c1ccccc1.
What is the InChIKey of [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate?
The InChIKey is CKXXKQOFOSIVMS-CMDGGOBGSA-N. The full InChI is InChI=1S/C18H15NO3S2/c19-17-11-10-16(22-24(20,21)18-7-4-12-23-18)13-15(17)9-8-14-5-2-1-3-6-14/h1-13H,19H2/b9-8+.
What are the key properties of [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate?
[4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate has a molecular weight of 357.46 g/mol, XLogP of 4.27, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-3-[(E)-2-phenylethenyl]phenyl] thiophene-2-sulfonate is sourced from PubChem (CID 58790827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).