C25H17BrN2O2 — CID 58790943
[3-(4-bromophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] acetate (PubChem CID 58790943) has the molecular formula C25H17BrN2O2 and a molecular weight of 457.33 g/mol. Its IUPAC name is [3-(4-bromophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] acetate.
| Compound Name | [3-(4-bromophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] acetate |
|---|---|
| PubChem CID | 58790943 |
| Molecular Formula | C25H17BrN2O2 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | [3-(4-bromophenyl)-4-phenyl-9H-pyrido[2,3-b]indol-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2[nH]c3ncc(-c4ccc(Br)cc4)c(-c4ccccc4)c3c2c1 |
| InChI | InChI=1S/C25H17BrN2O2/c1-15(29)30-19-11-12-22-20(13-19)24-23(17-5-3-2-4-6-17)21(14-27-25(24)28-22)16-7-9-18(26)10-8-16/h2-14H,1H3,(H,27,28) |
| InChIKey | RVRFJBPDEILTIM-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|