C26H22N4O2 — CID 154632633
N-[4-[3-[(9H-pyrido[3,4-b]indol-3-ylamino)methyl]phenoxy]phenyl]acetamide (PubChem CID 154632633) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[4-[3-[(9H-pyrido[3,4-b]indol-3-ylamino)methyl]phenoxy]phenyl]acetamide.
| Compound Name | N-[4-[3-[(9H-pyrido[3,4-b]indol-3-ylamino)methyl]phenoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 154632633 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | N-[4-[3-[(9H-pyrido[3,4-b]indol-3-ylamino)methyl]phenoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2cccc(CNc3cc4c(cn3)[nH]c3ccccc34)c2)cc1 |
| InChI | InChI=1S/C26H22N4O2/c1-17(31)29-19-9-11-20(12-10-19)32-21-6-4-5-18(13-21)15-27-26-14-23-22-7-2-3-8-24(22)30-25(23)16-28-26/h2-14,16,30H,15H2,1H3,(H,27,28)(H,29,31) |
| InChIKey | NLGFQLSIXKHHRZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |