C25H28N4O3 — CID 51041466
tert-butyl N-[2-[4-[(9H-pyrido[3,4-b]indol-3-ylamino)methyl]phenoxy]ethyl]carbamate (PubChem CID 51041466) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl N-[2-[4-[(9H-pyrido[3,4-b]indol-3-ylamino)methyl]phenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-[(9H-pyrido[3,4-b]indol-3-ylamino)methyl]phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 51041466 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | tert-butyl N-[2-[4-[(9H-pyrido[3,4-b]indol-3-ylamino)methyl]phenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(CNc2cc3c(cn2)[nH]c2ccccc23)cc1 |
| InChI | InChI=1S/C25H28N4O3/c1-25(2,3)32-24(30)26-12-13-31-18-10-8-17(9-11-18)15-27-23-14-20-19-6-4-5-7-21(19)29-22(20)16-28-23/h4-11,14,16,29H,12-13,15H2,1-3H3,(H,26,30)(H,27,28) |
| InChIKey | GRDIKLDRFLFJEF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|