C69H46IrN2-2 — CID 58792988
2-[2',7'-bis(4-naphthalen-2-ylphenyl)spiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl]pyridine;iridium;2-phenylpyridine (PubChem CID 58792988) has the molecular formula C69H46IrN2-2 and a molecular weight of 1095.36 g/mol. Its IUPAC name is 2-[2',7'-bis(4-naphthalen-2-ylphenyl)spiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl]pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-[2',7'-bis(4-naphthalen-2-ylphenyl)spiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl]pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 58792988 |
| Molecular Formula | C69H46IrN2-2 |
| Molecular Weight | 1095.36 g/mol |
| Exact Mass | 1095.33 |
| IUPAC Name | 2-[2',7'-bis(4-naphthalen-2-ylphenyl)spiro[3,6-dihydro-1H-inden-6-ide-2,9'-fluorene]-5-yl]pyridine;iridium;2-phenylpyridine |
| SMILES | [Ir].[c-]1cc2c(cc1-c1ccccn1)CC1(C2)c2cc(-c3ccc(-c4ccc5ccccc5c4)cc3)ccc2-c2ccc(-c3ccc(-c4ccc5ccccc5c4)cc3)cc21.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C58H38N.C11H8N.Ir/c1-3-9-44-31-46(22-20-38(44)7-1)40-12-16-42(17-13-40)48-26-28-53-54-29-27-49(43-18-14-41(15-19-43)47-23-21-39-8-2-4-10-45(39)32-47)35-56(54)58(55(53)34-48)36-51-25-24-50(33-52(51)37-58)57-11-5-6-30-59-57;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h1-23,25-35H,36-37H2;1-6,8-9H;/q2*-1; |
| InChIKey | SUISNVPAQQRNFH-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1095.36 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|