C17H25BClNO2 — CID 58793979
[4-[(1S,2S)-1-(4-chlorophenyl)-2-(methoxymethyl)cyclopropyl]piperidin-1-yl]-methylborinic acid (PubChem CID 58793979) has the molecular formula C17H25BClNO2 and a molecular weight of 321.66 g/mol. Its IUPAC name is [4-[(1S,2S)-1-(4-chlorophenyl)-2-(methoxymethyl)cyclopropyl]piperidin-1-yl]-methylborinic acid.
| Compound Name | [4-[(1S,2S)-1-(4-chlorophenyl)-2-(methoxymethyl)cyclopropyl]piperidin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 58793979 |
| Molecular Formula | C17H25BClNO2 |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [4-[(1S,2S)-1-(4-chlorophenyl)-2-(methoxymethyl)cyclopropyl]piperidin-1-yl]-methylborinic acid |
| SMILES | COC[C@H]1C[C@]1(c1ccc(Cl)cc1)C1CCN(B(C)O)CC1 |
| InChI | InChI=1S/C17H25BClNO2/c1-18(21)20-9-7-14(8-10-20)17(11-15(17)12-22-2)13-3-5-16(19)6-4-13/h3-6,14-15,21H,7-12H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | BIRHSLYGUWHQNQ-WBVHZDCISA-N |
| XLogP | 3.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|