About 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene
1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene (PubChem CID 169432317) has the molecular formula C13H12ClF3
and a molecular weight of 260.69 g/mol. Its IUPAC name is 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene.
Molecular Properties
| Compound Name | 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene |
| PubChem CID | 169432317 |
| Molecular Formula | C13H12ClF3 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene |
| SMILES | FC(F)(F)[C@@H]1C[C@]1(c1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C13H12ClF3/c14-10-5-3-9(4-6-10)12(8-1-2-8)7-11(12)13(15,16)17/h3-6,8,11H,1-2,7H2/t11-,12-/m1/s1 |
| InChIKey | YHWANMIQUFOLNG-VXGBXAGGSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene?
The IUPAC name of 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene (CID 169432317) is 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene.
What is the SMILES notation for 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene?
The canonical SMILES for 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene is FC(F)(F)[C@@H]1C[C@]1(c1ccc(Cl)cc1)C1CC1.
What is the InChIKey of 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene?
The InChIKey is YHWANMIQUFOLNG-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H12ClF3/c14-10-5-3-9(4-6-10)12(8-1-2-8)7-11(12)13(15,16)17/h3-6,8,11H,1-2,7H2/t11-,12-/m1/s1.
What are the key properties of 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene?
1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene has a molecular weight of 260.69 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-[(1S,2R)-1-cyclopropyl-2-(trifluoromethyl)cyclopropyl]benzene is sourced from PubChem (CID 169432317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).