C26H31F3N2O7S — CID 58795442
methyl 2-[[(2S)-4-methyl-2-[[4-[4-(trifluoromethylsulfonyloxy)phenyl]benzoyl]amino]pentanoyl]amino]pentanoate (PubChem CID 58795442) has the molecular formula C26H31F3N2O7S and a molecular weight of 572.60 g/mol. Its IUPAC name is methyl 2-[[(2S)-4-methyl-2-[[4-[4-(trifluoromethylsulfonyloxy)phenyl]benzoyl]amino]pentanoyl]amino]pentanoate.
| Compound Name | methyl 2-[[(2S)-4-methyl-2-[[4-[4-(trifluoromethylsulfonyloxy)phenyl]benzoyl]amino]pentanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 58795442 |
| Molecular Formula | C26H31F3N2O7S |
| Molecular Weight | 572.60 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | methyl 2-[[(2S)-4-methyl-2-[[4-[4-(trifluoromethylsulfonyloxy)phenyl]benzoyl]amino]pentanoyl]amino]pentanoate |
| SMILES | CCCC(NC(=O)[C@H](CC(C)C)NC(=O)c1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)cc2)cc1)C(=O)OC |
| InChI | InChI=1S/C26H31F3N2O7S/c1-5-6-21(25(34)37-4)30-24(33)22(15-16(2)3)31-23(32)19-9-7-17(8-10-19)18-11-13-20(14-12-18)38-39(35,36)26(27,28)29/h7-14,16,21-22H,5-6,15H2,1-4H3,(H,30,33)(H,31,32)/t21?,22-/m0/s1 |
| InChIKey | ONNGLXITTMYAPX-KEKNWZKVSA-N |
| XLogP | 4.18 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|