C17H11Cl2NO3 — CID 58796815
methyl 3-(2,4-dichlorobenzoyl)-3H-isoindole-1-carboxylate (PubChem CID 58796815) has the molecular formula C17H11Cl2NO3 and a molecular weight of 348.19 g/mol. Its IUPAC name is methyl 3-(2,4-dichlorobenzoyl)-3H-isoindole-1-carboxylate.
| Compound Name | methyl 3-(2,4-dichlorobenzoyl)-3H-isoindole-1-carboxylate |
|---|---|
| PubChem CID | 58796815 |
| Molecular Formula | C17H11Cl2NO3 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | methyl 3-(2,4-dichlorobenzoyl)-3H-isoindole-1-carboxylate |
| SMILES | COC(=O)C1=NC(C(=O)c2ccc(Cl)cc2Cl)c2ccccc21 |
| InChI | InChI=1S/C17H11Cl2NO3/c1-23-17(22)15-11-5-3-2-4-10(11)14(20-15)16(21)12-7-6-9(18)8-13(12)19/h2-8,14H,1H3 |
| InChIKey | PRBOWNLFYPWQGI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |