C14H24FNO4 — CID 58801166
5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid (PubChem CID 58801166) has the molecular formula C14H24FNO4 and a molecular weight of 289.35 g/mol. Its IUPAC name is 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid.
| Compound Name | 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid |
|---|---|
| PubChem CID | 58801166 |
| Molecular Formula | C14H24FNO4 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoic acid |
| SMILES | C=CCCC(F)CCC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H24FNO4/c1-5-6-7-10(15)8-9-11(12(17)18)16-13(19)20-14(2,3)4/h5,10-11H,1,6-9H2,2-4H3,(H,16,19)(H,17,18) |
| InChIKey | JPDVQWXZHWAEMY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|