C30H21AlN3O2 — CID 58803437
CID 58803437 (PubChem CID 58803437) has the molecular formula C30H21AlN3O2 and a molecular weight of 482.50 g/mol.
| Compound Name | CID 58803437 |
|---|---|
| PubChem CID | 58803437 |
| Molecular Formula | C30H21AlN3O2 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | — |
| SMILES | c1ccc(-c2ccc(O[Al]Oc3ccccc3-c3nc4cccnc4n3-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C18H13N3O.C12H10O.Al/c22-16-11-5-4-9-14(16)17-20-15-10-6-12-19-18(15)21(17)13-7-2-1-3-8-13;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;/h1-12,22H;1-9,13H;/q;;+2/p-2 |
| InChIKey | UYNXDHQCTFYXQG-UHFFFAOYSA-L |
| XLogP | 6.75 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |