C25H19NO2 — CID 58803548
[3-[4-(N-phenylanilino)phenyl]phenyl] formate (PubChem CID 58803548) has the molecular formula C25H19NO2 and a molecular weight of 365.43 g/mol. Its IUPAC name is [3-[4-(N-phenylanilino)phenyl]phenyl] formate.
| Compound Name | [3-[4-(N-phenylanilino)phenyl]phenyl] formate |
|---|---|
| PubChem CID | 58803548 |
| Molecular Formula | C25H19NO2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [3-[4-(N-phenylanilino)phenyl]phenyl] formate |
| SMILES | O=COc1cccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C25H19NO2/c27-19-28-25-13-7-8-21(18-25)20-14-16-24(17-15-20)26(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-19H |
| InChIKey | CYFUQECWXBKNNI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|