C32H25NO2 — CID 58803524
[4-[4-(4-methyl-N-(4-phenylphenyl)anilino)phenyl]phenyl] formate (PubChem CID 58803524) has the molecular formula C32H25NO2 and a molecular weight of 455.56 g/mol. Its IUPAC name is [4-[4-(4-methyl-N-(4-phenylphenyl)anilino)phenyl]phenyl] formate.
| Compound Name | [4-[4-(4-methyl-N-(4-phenylphenyl)anilino)phenyl]phenyl] formate |
|---|---|
| PubChem CID | 58803524 |
| Molecular Formula | C32H25NO2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | [4-[4-(4-methyl-N-(4-phenylphenyl)anilino)phenyl]phenyl] formate |
| SMILES | Cc1ccc(N(c2ccc(-c3ccccc3)cc2)c2ccc(-c3ccc(OC=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H25NO2/c1-24-7-15-29(16-8-24)33(30-17-9-26(10-18-30)25-5-3-2-4-6-25)31-19-11-27(12-20-31)28-13-21-32(22-14-28)35-23-34/h2-23H,1H3 |
| InChIKey | MRFFNZLBVJPNHT-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|