C23H34FNO4 — CID 58804769
7-[(2R)-2-[4-(2-fluoro-5-methylphenyl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]heptanoic acid (PubChem CID 58804769) has the molecular formula C23H34FNO4 and a molecular weight of 407.53 g/mol. Its IUPAC name is 7-[(2R)-2-[4-(2-fluoro-5-methylphenyl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-[4-(2-fluoro-5-methylphenyl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 58804769 |
| Molecular Formula | C23H34FNO4 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 7-[(2R)-2-[4-(2-fluoro-5-methylphenyl)-3-hydroxybutyl]-6-oxopiperidin-1-yl]heptanoic acid |
| SMILES | Cc1ccc(F)c(CC(O)CC[C@H]2CCCC(=O)N2CCCCCCC(=O)O)c1 |
| InChI | InChI=1S/C23H34FNO4/c1-17-10-13-21(24)18(15-17)16-20(26)12-11-19-7-6-8-22(27)25(19)14-5-3-2-4-9-23(28)29/h10,13,15,19-20,26H,2-9,11-12,14,16H2,1H3,(H,28,29)/t19-,20?/m1/s1 |
| InChIKey | IZKUSFHQQMVVKX-FIWHBWSRSA-N |
| XLogP | 4.23 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|