C9H17NO2 — CID 58805569
N-(2-butan-2-yloxyethyl)prop-2-enamide (PubChem CID 58805569) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is N-(2-butan-2-yloxyethyl)prop-2-enamide.
| Compound Name | N-(2-butan-2-yloxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 58805569 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-(2-butan-2-yloxyethyl)prop-2-enamide |
| SMILES | C=CC(=O)NCCOC(C)CC |
| InChI | InChI=1S/C9H17NO2/c1-4-8(3)12-7-6-10-9(11)5-2/h5,8H,2,4,6-7H2,1,3H3,(H,10,11) |
| InChIKey | NWQFIZFGDVIJPA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|