C16H18N4O3 — CID 58808769
N-(2-amino-2-oxoethyl)-5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)pyridine-3-carboxamide (PubChem CID 58808769) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)pyridine-3-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58808769 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-5-(5-ethyl-2-methyl-6-oxo-1H-pyridin-3-yl)pyridine-3-carboxamide |
| SMILES | CCc1cc(-c2cncc(C(=O)NCC(N)=O)c2)c(C)[nH]c1=O |
| InChI | InChI=1S/C16H18N4O3/c1-3-10-5-13(9(2)20-16(10)23)11-4-12(7-18-6-11)15(22)19-8-14(17)21/h4-7H,3,8H2,1-2H3,(H2,17,21)(H,19,22)(H,20,23) |
| InChIKey | BLGJKGNFWJPRMV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |