C28H33N5O3 — CID 58809285
methyl (2S)-3-methyl-2-[[2-[[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate (PubChem CID 58809285) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[2-[[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[2-[[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 58809285 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[2-[[4-[(E)-3-phenylprop-2-enoyl]piperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate |
| SMILES | COC(=O)[C@@H](Nc1nc(CN2CCN(C(=O)/C=C/c3ccccc3)CC2)nc2ccccc12)C(C)C |
| InChI | InChI=1S/C28H33N5O3/c1-20(2)26(28(35)36-3)31-27-22-11-7-8-12-23(22)29-24(30-27)19-32-15-17-33(18-16-32)25(34)14-13-21-9-5-4-6-10-21/h4-14,20,26H,15-19H2,1-3H3,(H,29,30,31)/b14-13+/t26-/m0/s1 |
| InChIKey | CQNWEOTUVOBGAC-ODUIWNOOSA-N |
| XLogP | 3.60 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|