C28H31N5O6S — CID 58809679
methyl (2S)-3-methyl-2-[[2-[[4-(2-oxochromen-6-yl)sulfonylpiperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate (PubChem CID 58809679) has the molecular formula C28H31N5O6S and a molecular weight of 565.65 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[2-[[4-(2-oxochromen-6-yl)sulfonylpiperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[2-[[4-(2-oxochromen-6-yl)sulfonylpiperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 58809679 |
| Molecular Formula | C28H31N5O6S |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[2-[[4-(2-oxochromen-6-yl)sulfonylpiperazin-1-yl]methyl]quinazolin-4-yl]amino]butanoate |
| SMILES | COC(=O)[C@@H](Nc1nc(CN2CCN(S(=O)(=O)c3ccc4oc(=O)ccc4c3)CC2)nc2ccccc12)C(C)C |
| InChI | InChI=1S/C28H31N5O6S/c1-18(2)26(28(35)38-3)31-27-21-6-4-5-7-22(21)29-24(30-27)17-32-12-14-33(15-13-32)40(36,37)20-9-10-23-19(16-20)8-11-25(34)39-23/h4-11,16,18,26H,12-15,17H2,1-3H3,(H,29,30,31)/t26-/m0/s1 |
| InChIKey | QKUCWPZKEMYAJX-SANMLTNESA-N |
| XLogP | 2.85 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|