C27H27N3O6S — CID 58810162
3-[6-(dimethylamino)pyridine-3-carbonyl]-6,7-dimethoxy-1-[(4-methylperoxysulfanylphenyl)methyl]quinolin-4-one (PubChem CID 58810162) has the molecular formula C27H27N3O6S and a molecular weight of 521.60 g/mol. Its IUPAC name is 3-[6-(dimethylamino)pyridine-3-carbonyl]-6,7-dimethoxy-1-[(4-methylperoxysulfanylphenyl)methyl]quinolin-4-one.
| Compound Name | 3-[6-(dimethylamino)pyridine-3-carbonyl]-6,7-dimethoxy-1-[(4-methylperoxysulfanylphenyl)methyl]quinolin-4-one |
|---|---|
| PubChem CID | 58810162 |
| Molecular Formula | C27H27N3O6S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 3-[6-(dimethylamino)pyridine-3-carbonyl]-6,7-dimethoxy-1-[(4-methylperoxysulfanylphenyl)methyl]quinolin-4-one |
| SMILES | COOSc1ccc(Cn2cc(C(=O)c3ccc(N(C)C)nc3)c(=O)c3cc(OC)c(OC)cc32)cc1 |
| InChI | InChI=1S/C27H27N3O6S/c1-29(2)25-11-8-18(14-28-25)26(31)21-16-30(15-17-6-9-19(10-7-17)37-36-35-5)22-13-24(34-4)23(33-3)12-20(22)27(21)32/h6-14,16H,15H2,1-5H3 |
| InChIKey | WONGSNPIDZTZNQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 92.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|