C9H13N5 — CID 58811327
7-propan-2-ylpyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 58811327) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 7-propan-2-ylpyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 7-propan-2-ylpyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 58811327 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 7-propan-2-ylpyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CC(C)n1ccc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C9H13N5/c1-5(2)14-4-3-6-7(10)12-9(11)13-8(6)14/h3-5H,1-2H3,(H4,10,11,12,13) |
| InChIKey | UKCIICOLKYTSNQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |