C17H22IrN3O2- — CID 58814037
2-(3-tert-butyl-5H-pyrazol-5-id-1-yl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium (PubChem CID 58814037) has the molecular formula C17H22IrN3O2- and a molecular weight of 492.60 g/mol. Its IUPAC name is 2-(3-tert-butyl-5H-pyrazol-5-id-1-yl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 2-(3-tert-butyl-5H-pyrazol-5-id-1-yl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 58814037 |
| Molecular Formula | C17H22IrN3O2- |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-(3-tert-butyl-5H-pyrazol-5-id-1-yl)pyridine;(Z)-4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)/C=C(/C)O.CC(C)(C)c1c[c-]n(-c2ccccn2)n1.[Ir] |
| InChI | InChI=1S/C12H14N3.C5H8O2.Ir/c1-12(2,3)10-7-9-15(14-10)11-6-4-5-8-13-11;1-4(6)3-5(2)7;/h4-8H,1-3H3;3,6H,1-2H3;/q-1;;/b;4-3-; |
| InChIKey | LHHFEQIKULDRIX-LWFKIUJUSA-N |
| XLogP | 3.40 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|