C11H25NS — CID 58815164
(2S)-1-tert-butylsulfanyl-2,4-dimethylpentan-2-amine (PubChem CID 58815164) has the molecular formula C11H25NS and a molecular weight of 203.39 g/mol. Its IUPAC name is (2S)-1-tert-butylsulfanyl-2,4-dimethylpentan-2-amine.
| Compound Name | (2S)-1-tert-butylsulfanyl-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 58815164 |
| Molecular Formula | C11H25NS |
| Molecular Weight | 203.39 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2S)-1-tert-butylsulfanyl-2,4-dimethylpentan-2-amine |
| SMILES | CC(C)C[C@](C)(N)CSC(C)(C)C |
| InChI | InChI=1S/C11H25NS/c1-9(2)7-11(6,12)8-13-10(3,4)5/h9H,7-8,12H2,1-6H3/t11-/m0/s1 |
| InChIKey | ZZVVMSYSMCONJC-NSHDSACASA-N |
| XLogP | 3.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |