C26H37N3O — CID 58815650
1,1-dimethyl-3-[(1S)-1'-[(6S,8R)-8-tricyclo[4.3.0.01,3]nonanyl]spiro[2,3-dihydro-1H-naphthalene-4,4'-piperidine]-1-yl]urea (PubChem CID 58815650) has the molecular formula C26H37N3O and a molecular weight of 407.60 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(1S)-1'-[(6S,8R)-8-tricyclo[4.3.0.01,3]nonanyl]spiro[2,3-dihydro-1H-naphthalene-4,4'-piperidine]-1-yl]urea.
| Compound Name | 1,1-dimethyl-3-[(1S)-1'-[(6S,8R)-8-tricyclo[4.3.0.01,3]nonanyl]spiro[2,3-dihydro-1H-naphthalene-4,4'-piperidine]-1-yl]urea |
|---|---|
| PubChem CID | 58815650 |
| Molecular Formula | C26H37N3O |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.29 |
| IUPAC Name | 1,1-dimethyl-3-[(1S)-1'-[(6S,8R)-8-tricyclo[4.3.0.01,3]nonanyl]spiro[2,3-dihydro-1H-naphthalene-4,4'-piperidine]-1-yl]urea |
| SMILES | CN(C)C(=O)N[C@H]1CCC2(CCN([C@@H]3C[C@@H]4CCC5CC54C3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H37N3O/c1-28(2)24(30)27-23-9-10-25(22-6-4-3-5-21(22)23)11-13-29(14-12-25)20-15-18-7-8-19-16-26(18,19)17-20/h3-6,18-20,23H,7-17H2,1-2H3,(H,27,30)/t18-,19?,20+,23-,26?/m0/s1 |
| InChIKey | OZIXDPOJINTXPH-ZEXCQICRSA-N |
| XLogP | 4.70 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |