C30H44N4O2 — CID 58815657
3-[(1R)-1'-[2-(2,2-dimethylpropanoyl)-2-azatricyclo[4.3.0.01,3]nonan-8-yl]spiro[2,3-dihydro-1H-naphthalene-4,4'-piperidine]-1-yl]-1,1-dimethylurea (PubChem CID 58815657) has the molecular formula C30H44N4O2 and a molecular weight of 492.71 g/mol. Its IUPAC name is 3-[(1R)-1'-[2-(2,2-dimethylpropanoyl)-2-azatricyclo[4.3.0.01,3]nonan-8-yl]spiro[2,3-dihydro-1H-naphthalene-4,4'-piperidine]-1-yl]-1,1-dimethylurea.
| Compound Name | 3-[(1R)-1'-[2-(2,2-dimethylpropanoyl)-2-azatricyclo[4.3.0.01,3]nonan-8-yl]spiro[2,3-dihydro-1H-naphthalene-4,4'-piperidine]-1-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 58815657 |
| Molecular Formula | C30H44N4O2 |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | 3-[(1R)-1'-[2-(2,2-dimethylpropanoyl)-2-azatricyclo[4.3.0.01,3]nonan-8-yl]spiro[2,3-dihydro-1H-naphthalene-4,4'-piperidine]-1-yl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)N[C@@H]1CCC2(CCN(C3CC4CCC5N(C(=O)C(C)(C)C)C45C3)CC2)c2ccccc21 |
| InChI | InChI=1S/C30H44N4O2/c1-28(2,3)26(35)34-25-11-10-20-18-21(19-30(20,25)34)33-16-14-29(15-17-33)13-12-24(31-27(36)32(4)5)22-8-6-7-9-23(22)29/h6-9,20-21,24-25H,10-19H2,1-5H3,(H,31,36)/t20?,21?,24-,25?,30?,34?/m1/s1 |
| InChIKey | QEFBNKYMDAJPFD-QHYFDPPJSA-N |
| XLogP | 4.69 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|