C28H33NO3S — CID 58816031
ethyl 3-methyl-2-[4-[2-(4-phenylmethoxyphenyl)ethylamino]phenyl]sulfanylbutanoate (PubChem CID 58816031) has the molecular formula C28H33NO3S and a molecular weight of 463.64 g/mol. Its IUPAC name is ethyl 3-methyl-2-[4-[2-(4-phenylmethoxyphenyl)ethylamino]phenyl]sulfanylbutanoate.
| Compound Name | ethyl 3-methyl-2-[4-[2-(4-phenylmethoxyphenyl)ethylamino]phenyl]sulfanylbutanoate |
|---|---|
| PubChem CID | 58816031 |
| Molecular Formula | C28H33NO3S |
| Molecular Weight | 463.64 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | ethyl 3-methyl-2-[4-[2-(4-phenylmethoxyphenyl)ethylamino]phenyl]sulfanylbutanoate |
| SMILES | CCOC(=O)C(Sc1ccc(NCCc2ccc(OCc3ccccc3)cc2)cc1)C(C)C |
| InChI | InChI=1S/C28H33NO3S/c1-4-31-28(30)27(21(2)3)33-26-16-12-24(13-17-26)29-19-18-22-10-14-25(15-11-22)32-20-23-8-6-5-7-9-23/h5-17,21,27,29H,4,18-20H2,1-3H3 |
| InChIKey | RXFHPLIVGMFPKA-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.64 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |