C15H25N3O3S — CID 58817392
N-[(2R)-1-[2-(4-methylpiperazin-1-yl)phenoxy]propan-2-yl]methanesulfonamide (PubChem CID 58817392) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-[(2R)-1-[2-(4-methylpiperazin-1-yl)phenoxy]propan-2-yl]methanesulfonamide.
| Compound Name | N-[(2R)-1-[2-(4-methylpiperazin-1-yl)phenoxy]propan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 58817392 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-[(2R)-1-[2-(4-methylpiperazin-1-yl)phenoxy]propan-2-yl]methanesulfonamide |
| SMILES | C[C@H](COc1ccccc1N1CCN(C)CC1)NS(C)(=O)=O |
| InChI | InChI=1S/C15H25N3O3S/c1-13(16-22(3,19)20)12-21-15-7-5-4-6-14(15)18-10-8-17(2)9-11-18/h4-7,13,16H,8-12H2,1-3H3/t13-/m1/s1 |
| InChIKey | YUOWYNKPUFAQPP-CYBMUJFWSA-N |
| XLogP | 0.75 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |