C16H12N4 — CID 58820202
2-methyl-4-pyrrolo[3,2-c]pyridin-1-ylquinazoline (PubChem CID 58820202) has the molecular formula C16H12N4 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-methyl-4-pyrrolo[3,2-c]pyridin-1-ylquinazoline.
| Compound Name | 2-methyl-4-pyrrolo[3,2-c]pyridin-1-ylquinazoline |
|---|---|
| PubChem CID | 58820202 |
| Molecular Formula | C16H12N4 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-methyl-4-pyrrolo[3,2-c]pyridin-1-ylquinazoline |
| SMILES | Cc1nc(-n2ccc3cnccc32)c2ccccc2n1 |
| InChI | InChI=1S/C16H12N4/c1-11-18-14-5-3-2-4-13(14)16(19-11)20-9-7-12-10-17-8-6-15(12)20/h2-10H,1H3 |
| InChIKey | DWEAUDCGSAEUNJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |