C20H22N4O5 — CID 58821223
ethyl 6,9-dioxo-5-phenylmethoxy-1,3,7,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4-diene-4-carboxylate (PubChem CID 58821223) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl 6,9-dioxo-5-phenylmethoxy-1,3,7,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4-diene-4-carboxylate.
| Compound Name | ethyl 6,9-dioxo-5-phenylmethoxy-1,3,7,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4-diene-4-carboxylate |
|---|---|
| PubChem CID | 58821223 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | ethyl 6,9-dioxo-5-phenylmethoxy-1,3,7,10-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4-diene-4-carboxylate |
| SMILES | CCOC(=O)c1nc2n(c(=O)c1OCc1ccccc1)CC(=O)N1CCCCN21 |
| InChI | InChI=1S/C20H22N4O5/c1-2-28-19(27)16-17(29-13-14-8-4-3-5-9-14)18(26)22-12-15(25)23-10-6-7-11-24(23)20(22)21-16/h3-5,8-9H,2,6-7,10-13H2,1H3 |
| InChIKey | BOENZLAYIFXOGI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |