C24H29N3O6 — CID 59022456
1-O'-benzyl 2-O-ethyl 3-hydroxy-4-oxospiro[6,7,8,9-tetrahydropyrimido[1,2-a]azepine-10,4'-piperidine]-1',2-dicarboxylate (PubChem CID 59022456) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is 1-O'-benzyl 2-O-ethyl 3-hydroxy-4-oxospiro[6,7,8,9-tetrahydropyrimido[1,2-a]azepine-10,4'-piperidine]-1',2-dicarboxylate.
| Compound Name | 1-O'-benzyl 2-O-ethyl 3-hydroxy-4-oxospiro[6,7,8,9-tetrahydropyrimido[1,2-a]azepine-10,4'-piperidine]-1',2-dicarboxylate |
|---|---|
| PubChem CID | 59022456 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 1-O'-benzyl 2-O-ethyl 3-hydroxy-4-oxospiro[6,7,8,9-tetrahydropyrimido[1,2-a]azepine-10,4'-piperidine]-1',2-dicarboxylate |
| SMILES | CCOC(=O)c1nc2n(c(=O)c1O)CCCCC21CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O6/c1-2-32-21(30)18-19(28)20(29)27-13-7-6-10-24(22(27)25-18)11-14-26(15-12-24)23(31)33-16-17-8-4-3-5-9-17/h3-5,8-9,28H,2,6-7,10-16H2,1H3 |
| InChIKey | SDXFUCPWKYJSGO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |