C48H94N4O2+2 — CID 58823256
3-[[3,4-dihexyl-5-[(Z)-[2-[[3-(trimethylazaniumyl)propylamino]oxymethyl]cyclooctylidene]methyl]spiro[5.7]tridec-1-en-13-yl]methoxyamino]propyl-trimethylazanium (PubChem CID 58823256) has the molecular formula C48H94N4O2+2 and a molecular weight of 759.31 g/mol. Its IUPAC name is 3-[[3,4-dihexyl-5-[(Z)-[2-[[3-(trimethylazaniumyl)propylamino]oxymethyl]cyclooctylidene]methyl]spiro[5.7]tridec-1-en-13-yl]methoxyamino]propyl-trimethylazanium.
| Compound Name | 3-[[3,4-dihexyl-5-[(Z)-[2-[[3-(trimethylazaniumyl)propylamino]oxymethyl]cyclooctylidene]methyl]spiro[5.7]tridec-1-en-13-yl]methoxyamino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 58823256 |
| Molecular Formula | C48H94N4O2+2 |
| Molecular Weight | 759.31 g/mol |
| Exact Mass | 758.74 |
| IUPAC Name | 3-[[3,4-dihexyl-5-[(Z)-[2-[[3-(trimethylazaniumyl)propylamino]oxymethyl]cyclooctylidene]methyl]spiro[5.7]tridec-1-en-13-yl]methoxyamino]propyl-trimethylazanium |
| SMILES | CCCCCCC1C=CC2(CCCCCCC2CONCCC[N+](C)(C)C)C(/C=C2/CCCCCCC2CONCCC[N+](C)(C)C)C1CCCCCC |
| InChI | InChI=1S/C48H94N4O2/c1-9-11-13-19-27-42-32-34-48(33-24-18-17-22-30-45(48)41-54-50-36-26-38-52(6,7)8)47(46(42)31-23-14-12-10-2)39-43-28-20-15-16-21-29-44(43)40-53-49-35-25-37-51(3,4)5/h32,34,39,42,44-47,49-50H,9-31,33,35-38,40-41H2,1-8H3/q+2/b43-39- |
| InChIKey | KCCLMOWETFCCKZ-MBJURZOESA-N |
| XLogP | 11.43 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.31 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|