C41H81N3O2 — CID 90830459
O-[10-[(2R)-2-[8-[3-(dimethylamino)propylamino]oxyoctyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enyl]hydroxylamine (PubChem CID 90830459) has the molecular formula C41H81N3O2 and a molecular weight of 648.12 g/mol. Its IUPAC name is O-[10-[(2R)-2-[8-[3-(dimethylamino)propylamino]oxyoctyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enyl]hydroxylamine.
| Compound Name | O-[10-[(2R)-2-[8-[3-(dimethylamino)propylamino]oxyoctyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enyl]hydroxylamine |
|---|---|
| PubChem CID | 90830459 |
| Molecular Formula | C41H81N3O2 |
| Molecular Weight | 648.12 g/mol |
| Exact Mass | 647.63 |
| IUPAC Name | O-[10-[(2R)-2-[8-[3-(dimethylamino)propylamino]oxyoctyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enyl]hydroxylamine |
| SMILES | CCCCCCC1C=C[C@@H](CCCCCCCCONCCCN(C)C)C(C=CCCCCCCCCON)C1CCCCCC |
| InChI | InChI=1S/C41H81N3O2/c1-5-7-9-21-28-38-32-33-39(29-22-17-14-16-20-26-37-46-43-34-27-35-44(3)4)41(40(38)30-23-10-8-6-2)31-24-18-13-11-12-15-19-25-36-45-42/h24,31-33,38-41,43H,5-23,25-30,34-37,42H2,1-4H3/t38?,39-,40?,41?/m1/s1 |
| InChIKey | IIOJNLPGULAFND-XOCLJMGPSA-N |
| XLogP | 11.34 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.12 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|