C31H62N2O4 — CID 91165426
N',N'-dimethylpropane-1,3-diamine;4-[(Z)-10-hydroperoxydec-1-enyl]-3-(8-hydroperoxyoctyl)-5,6-dimethylcyclohexene (PubChem CID 91165426) has the molecular formula C31H62N2O4 and a molecular weight of 526.85 g/mol. Its IUPAC name is N',N'-dimethylpropane-1,3-diamine;4-[(Z)-10-hydroperoxydec-1-enyl]-3-(8-hydroperoxyoctyl)-5,6-dimethylcyclohexene.
| Compound Name | N',N'-dimethylpropane-1,3-diamine;4-[(Z)-10-hydroperoxydec-1-enyl]-3-(8-hydroperoxyoctyl)-5,6-dimethylcyclohexene |
|---|---|
| PubChem CID | 91165426 |
| Molecular Formula | C31H62N2O4 |
| Molecular Weight | 526.85 g/mol |
| Exact Mass | 526.47 |
| IUPAC Name | N',N'-dimethylpropane-1,3-diamine;4-[(Z)-10-hydroperoxydec-1-enyl]-3-(8-hydroperoxyoctyl)-5,6-dimethylcyclohexene |
| SMILES | CC1C=CC(CCCCCCCCOO)C(/C=C\CCCCCCCCOO)C1C.CN(C)CCCN |
| InChI | InChI=1S/C26H48O4.C5H14N2/c1-23-19-20-25(17-13-9-6-8-12-16-22-30-28)26(24(23)2)18-14-10-5-3-4-7-11-15-21-29-27;1-7(2)5-3-4-6/h14,18-20,23-28H,3-13,15-17,21-22H2,1-2H3;3-6H2,1-2H3/b18-14-; |
| InChIKey | VOKCBKRBUIJGKB-NYAKATHWSA-N |
| XLogP | 7.95 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.85 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|