C44H86N2O4 — CID 58763460
2-[(Z)-10-[(2R)-2-[8-[2-(dimethylamino)ethylperoxy]octyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enyl]peroxy-N,N-dimethylethanamine (PubChem CID 58763460) has the molecular formula C44H86N2O4 and a molecular weight of 707.18 g/mol. Its IUPAC name is 2-[(Z)-10-[(2R)-2-[8-[2-(dimethylamino)ethylperoxy]octyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enyl]peroxy-N,N-dimethylethanamine.
| Compound Name | 2-[(Z)-10-[(2R)-2-[8-[2-(dimethylamino)ethylperoxy]octyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enyl]peroxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 58763460 |
| Molecular Formula | C44H86N2O4 |
| Molecular Weight | 707.18 g/mol |
| Exact Mass | 706.66 |
| IUPAC Name | 2-[(Z)-10-[(2R)-2-[8-[2-(dimethylamino)ethylperoxy]octyl]-5,6-dihexylcyclohex-3-en-1-yl]dec-9-enyl]peroxy-N,N-dimethylethanamine |
| SMILES | CCCCCCC1C=C[C@@H](CCCCCCCCOOCCN(C)C)C(/C=C\CCCCCCCCOOCCN(C)C)C1CCCCCC |
| InChI | InChI=1S/C44H86N2O4/c1-7-9-11-23-29-41-33-34-42(30-24-19-16-18-22-28-38-48-50-40-36-46(5)6)44(43(41)31-25-12-10-8-2)32-26-20-15-13-14-17-21-27-37-47-49-39-35-45(3)4/h26,32-34,41-44H,7-25,27-31,35-40H2,1-6H3/b32-26-/t41?,42-,43?,44?/m1/s1 |
| InChIKey | VWOYKOCYTNDUDT-CBAUVCSESA-N |
| XLogP | 12.00 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.18 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|