C46H90N2O4+2 — CID 58763467
2-[[(6S)-3,4-dihexyl-5-[(Z)-10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]spiro[5.7]tridec-1-en-13-yl]methylperoxy]ethyl-trimethylazanium (PubChem CID 58763467) has the molecular formula C46H90N2O4+2 and a molecular weight of 735.24 g/mol. Its IUPAC name is 2-[[(6S)-3,4-dihexyl-5-[(Z)-10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]spiro[5.7]tridec-1-en-13-yl]methylperoxy]ethyl-trimethylazanium.
| Compound Name | 2-[[(6S)-3,4-dihexyl-5-[(Z)-10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]spiro[5.7]tridec-1-en-13-yl]methylperoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 58763467 |
| Molecular Formula | C46H90N2O4+2 |
| Molecular Weight | 735.24 g/mol |
| Exact Mass | 734.69 |
| IUPAC Name | 2-[[(6S)-3,4-dihexyl-5-[(Z)-10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]spiro[5.7]tridec-1-en-13-yl]methylperoxy]ethyl-trimethylazanium |
| SMILES | CCCCCCC1C=C[C@@]2(CCCCCCC2COOCC[N+](C)(C)C)C(/C=C\CCCCCCCCOOCC[N+](C)(C)C)C1CCCCCC |
| InChI | InChI=1S/C46H90N2O4/c1-9-11-13-23-29-42-33-35-46(34-27-21-20-24-30-43(46)41-52-51-40-37-48(6,7)8)45(44(42)31-25-14-12-10-2)32-26-19-17-15-16-18-22-28-38-49-50-39-36-47(3,4)5/h26,32-33,35,42-45H,9-25,27-31,34,36-41H2,1-8H3/q+2/b32-26-/t42?,43?,44?,45?,46-/m1/s1 |
| InChIKey | VHKCBFJBQMXLKC-WJFPEUKBSA-N |
| XLogP | 11.90 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.24 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|