C45H89N2O4+ — CID 58763455
2-[8-[(1R)-6-[(Z)-10-[2-(dimethylamino)ethylperoxy]dec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium (PubChem CID 58763455) has the molecular formula C45H89N2O4+ and a molecular weight of 722.22 g/mol. Its IUPAC name is 2-[8-[(1R)-6-[(Z)-10-[2-(dimethylamino)ethylperoxy]dec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium.
| Compound Name | 2-[8-[(1R)-6-[(Z)-10-[2-(dimethylamino)ethylperoxy]dec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 58763455 |
| Molecular Formula | C45H89N2O4+ |
| Molecular Weight | 722.22 g/mol |
| Exact Mass | 721.68 |
| IUPAC Name | 2-[8-[(1R)-6-[(Z)-10-[2-(dimethylamino)ethylperoxy]dec-1-enyl]-4,5-dihexylcyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium |
| SMILES | CCCCCCC1C=C[C@@H](CCCCCCCCOOCC[N+](C)(C)C)C(/C=C\CCCCCCCCOOCCN(C)C)C1CCCCCC |
| InChI | InChI=1S/C45H89N2O4/c1-8-10-12-24-30-42-34-35-43(31-25-20-17-19-23-29-39-49-51-41-37-47(5,6)7)45(44(42)32-26-13-11-9-2)33-27-21-16-14-15-18-22-28-38-48-50-40-36-46(3)4/h27,33-35,42-45H,8-26,28-32,36-41H2,1-7H3/q+1/b33-27-/t42?,43-,44?,45?/m1/s1 |
| InChIKey | MSRQCKVAGGIEAB-ROLOIZKYSA-N |
| XLogP | 12.14 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.22 |
| LogP ≤ 5 | 12.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|