C41H82N2O4+2 — CID 91278471
2-[8-[(1R)-5-hexyl-4-methyl-6-[(Z)-10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]cyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium (PubChem CID 91278471) has the molecular formula C41H82N2O4+2 and a molecular weight of 667.12 g/mol. Its IUPAC name is 2-[8-[(1R)-5-hexyl-4-methyl-6-[(Z)-10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]cyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium.
| Compound Name | 2-[8-[(1R)-5-hexyl-4-methyl-6-[(Z)-10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]cyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 91278471 |
| Molecular Formula | C41H82N2O4+2 |
| Molecular Weight | 667.12 g/mol |
| Exact Mass | 666.63 |
| IUPAC Name | 2-[8-[(1R)-5-hexyl-4-methyl-6-[(Z)-10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]cyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium |
| SMILES | CCCCCCC1C(C)C=C[C@@H](CCCCCCCCOOCC[N+](C)(C)C)C1/C=C\CCCCCCCCOOCC[N+](C)(C)C |
| InChI | InChI=1S/C41H82N2O4/c1-9-10-11-23-28-40-38(2)30-31-39(27-22-18-15-17-21-26-35-45-47-37-33-43(6,7)8)41(40)29-24-19-14-12-13-16-20-25-34-44-46-36-32-42(3,4)5/h24,29-31,38-41H,9-23,25-28,32-37H2,1-8H3/q+2/b29-24-/t38?,39-,40?,41?/m1/s1 |
| InChIKey | FIKKILDDGMBUPC-QQNKQDALSA-N |
| XLogP | 10.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.12 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|