C46H92N2O4+2 — CID 91454222
2-[8-[(1R)-4,5-dihexyl-6-[10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]cyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium (PubChem CID 91454222) has the molecular formula C46H92N2O4+2 and a molecular weight of 737.25 g/mol. Its IUPAC name is 2-[8-[(1R)-4,5-dihexyl-6-[10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]cyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium.
| Compound Name | 2-[8-[(1R)-4,5-dihexyl-6-[10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]cyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 91454222 |
| Molecular Formula | C46H92N2O4+2 |
| Molecular Weight | 737.25 g/mol |
| Exact Mass | 736.70 |
| IUPAC Name | 2-[8-[(1R)-4,5-dihexyl-6-[10-[2-(trimethylazaniumyl)ethylperoxy]dec-1-enyl]cyclohex-2-en-1-yl]octylperoxy]ethyl-trimethylazanium |
| SMILES | CCCCCCC1C=C[C@@H](CCCCCCCCOOCC[N+](C)(C)C)C(C=CCCCCCCCCOOCC[N+](C)(C)C)C1CCCCCC |
| InChI | InChI=1S/C46H92N2O4/c1-9-11-13-25-31-43-35-36-44(32-26-21-18-20-24-30-40-50-52-42-38-48(6,7)8)46(45(43)33-27-14-12-10-2)34-28-22-17-15-16-19-23-29-39-49-51-41-37-47(3,4)5/h28,34-36,43-46H,9-27,29-33,37-42H2,1-8H3/q+2/t43?,44-,45?,46?/m1/s1 |
| InChIKey | FJEVFQJLRMAANB-DZWXSZNKSA-N |
| XLogP | 12.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.25 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|