C27H34N2O2 — CID 58823447
5-butyl-4-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-phenylpyrazol-3-one (PubChem CID 58823447) has the molecular formula C27H34N2O2 and a molecular weight of 418.58 g/mol. Its IUPAC name is 5-butyl-4-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-phenylpyrazol-3-one.
| Compound Name | 5-butyl-4-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 58823447 |
| Molecular Formula | C27H34N2O2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 5-butyl-4-(3,5-ditert-butyl-4-oxocyclohexa-2,5-dien-1-ylidene)-2-phenylpyrazol-3-one |
| SMILES | CCCCC1=NN(c2ccccc2)C(=O)C1=C1C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C27H34N2O2/c1-8-9-15-22-23(25(31)29(28-22)19-13-11-10-12-14-19)18-16-20(26(2,3)4)24(30)21(17-18)27(5,6)7/h10-14,16-17H,8-9,15H2,1-7H3 |
| InChIKey | HWFIDFGUSUBLAC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|