C23H21N5O3 — CID 143349095
4-[(4Z)-3-butyl-5-oxo-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylidene]pyrazol-1-yl]benzoic acid (PubChem CID 143349095) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-[(4Z)-3-butyl-5-oxo-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylidene]pyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4Z)-3-butyl-5-oxo-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylidene]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 143349095 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-[(4Z)-3-butyl-5-oxo-4-[[4-(1,2,4-triazol-1-yl)phenyl]methylidene]pyrazol-1-yl]benzoic acid |
| SMILES | CCCCC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C\c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C23H21N5O3/c1-2-3-4-21-20(13-16-5-9-18(10-6-16)27-15-24-14-25-27)22(29)28(26-21)19-11-7-17(8-12-19)23(30)31/h5-15H,2-4H2,1H3,(H,30,31)/b20-13- |
| InChIKey | QABLRWDOJUQUNB-MOSHPQCFSA-N |
| XLogP | 3.94 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|