C23H22ClN3O6 — CID 19616871
4-[(4E)-4-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylidene]-5-oxo-3-propylpyrazol-1-yl]benzoic acid (PubChem CID 19616871) has the molecular formula C23H22ClN3O6 and a molecular weight of 471.90 g/mol. Its IUPAC name is 4-[(4E)-4-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylidene]-5-oxo-3-propylpyrazol-1-yl]benzoic acid.
| Compound Name | 4-[(4E)-4-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylidene]-5-oxo-3-propylpyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 19616871 |
| Molecular Formula | C23H22ClN3O6 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 4-[(4E)-4-[[4-(2-amino-2-oxoethoxy)-3-chloro-5-methoxyphenyl]methylidene]-5-oxo-3-propylpyrazol-1-yl]benzoic acid |
| SMILES | CCCC1=NN(c2ccc(C(=O)O)cc2)C(=O)/C1=C/c1cc(Cl)c(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C23H22ClN3O6/c1-3-4-18-16(22(29)27(26-18)15-7-5-14(6-8-15)23(30)31)9-13-10-17(24)21(19(11-13)32-2)33-12-20(25)28/h5-11H,3-4,12H2,1-2H3,(H2,25,28)(H,30,31)/b16-9+ |
| InChIKey | RSKIRGHJEPCZFJ-CXUHLZMHSA-N |
| XLogP | 3.50 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|