C32H32BrN3O6 — CID 71834115
ethyl 4-[4-[[4-[2-(benzylamino)-2-oxoethoxy]-3-bromo-5-methoxyphenyl]methylidene]-5-oxo-3-propylpyrazol-1-yl]benzoate (PubChem CID 71834115) has the molecular formula C32H32BrN3O6 and a molecular weight of 634.53 g/mol. Its IUPAC name is ethyl 4-[4-[[4-[2-(benzylamino)-2-oxoethoxy]-3-bromo-5-methoxyphenyl]methylidene]-5-oxo-3-propylpyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[[4-[2-(benzylamino)-2-oxoethoxy]-3-bromo-5-methoxyphenyl]methylidene]-5-oxo-3-propylpyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 71834115 |
| Molecular Formula | C32H32BrN3O6 |
| Molecular Weight | 634.53 g/mol |
| Exact Mass | 633.15 |
| IUPAC Name | ethyl 4-[4-[[4-[2-(benzylamino)-2-oxoethoxy]-3-bromo-5-methoxyphenyl]methylidene]-5-oxo-3-propylpyrazol-1-yl]benzoate |
| SMILES | CCCC1=NN(c2ccc(C(=O)OCC)cc2)C(=O)C1=Cc1cc(Br)c(OCC(=O)NCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C32H32BrN3O6/c1-4-9-27-25(31(38)36(35-27)24-14-12-23(13-15-24)32(39)41-5-2)16-22-17-26(33)30(28(18-22)40-3)42-20-29(37)34-19-21-10-7-6-8-11-21/h6-8,10-18H,4-5,9,19-20H2,1-3H3,(H,34,37) |
| InChIKey | ZGHBXQNUKJRGLO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|