C58H58N2O2Si3 — CID 58825856
4-[(E)-2-[4-[[[dimethyl-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]ethenyl]-N,N-diphenylaniline (PubChem CID 58825856) has the molecular formula C58H58N2O2Si3 and a molecular weight of 899.37 g/mol. Its IUPAC name is 4-[(E)-2-[4-[[[dimethyl-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]ethenyl]-N,N-diphenylaniline.
| Compound Name | 4-[(E)-2-[4-[[[dimethyl-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 58825856 |
| Molecular Formula | C58H58N2O2Si3 |
| Molecular Weight | 899.37 g/mol |
| Exact Mass | 898.38 |
| IUPAC Name | 4-[(E)-2-[4-[[[dimethyl-[4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]ethenyl]-N,N-diphenylaniline |
| SMILES | C[Si](C)(O[Si](C)(C)c1ccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1)O[Si](C)(C)c1ccc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C58H58N2O2Si3/c1-63(2,57-43-35-49(36-44-57)29-27-47-31-39-55(40-32-47)59(51-19-11-7-12-20-51)52-21-13-8-14-22-52)61-65(5,6)62-64(3,4)58-45-37-50(38-46-58)30-28-48-33-41-56(42-34-48)60(53-23-15-9-16-24-53)54-25-17-10-18-26-54/h7-46H,1-6H3/b29-27+,30-28+ |
| InChIKey | FJHYYKAPZGHKPM-QAVVBOBSSA-N |
| XLogP | 15.23 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.37 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|