C9H11O5Rf- — CID 58825971
3-ethyl-4-[1-(oxomethoxy)ethyl]oxolane-2,5-dione;rutherfordium (PubChem CID 58825971) has the molecular formula C9H11O5Rf- and a molecular weight of 466.18 g/mol. Its IUPAC name is 3-ethyl-4-[1-(oxomethoxy)ethyl]oxolane-2,5-dione;rutherfordium.
| Compound Name | 3-ethyl-4-[1-(oxomethoxy)ethyl]oxolane-2,5-dione;rutherfordium |
|---|---|
| PubChem CID | 58825971 |
| Molecular Formula | C9H11O5Rf- |
| Molecular Weight | 466.18 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 3-ethyl-4-[1-(oxomethoxy)ethyl]oxolane-2,5-dione;rutherfordium |
| SMILES | CCC1C(=O)OC(=O)C1C(C)O[C-]=O.[Rf] |
| InChI | InChI=1S/C9H11O5.Rf/c1-3-6-7(5(2)13-4-10)9(12)14-8(6)11;/h5-7H,3H2,1-2H3;/q-1; |
| InChIKey | FDXCPMLDDNTFNP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.18 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|