C17H19N3O2 — CID 58826604
methyl 2-(3-cyclohexyl-6-isocyanopyrrolo[2,3-b]pyridin-1-yl)acetate (PubChem CID 58826604) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is methyl 2-(3-cyclohexyl-6-isocyanopyrrolo[2,3-b]pyridin-1-yl)acetate.
| Compound Name | methyl 2-(3-cyclohexyl-6-isocyanopyrrolo[2,3-b]pyridin-1-yl)acetate |
|---|---|
| PubChem CID | 58826604 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | methyl 2-(3-cyclohexyl-6-isocyanopyrrolo[2,3-b]pyridin-1-yl)acetate |
| SMILES | [C-]#[N+]c1ccc2c(C3CCCCC3)cn(CC(=O)OC)c2n1 |
| InChI | InChI=1S/C17H19N3O2/c1-18-15-9-8-13-14(12-6-4-3-5-7-12)10-20(17(13)19-15)11-16(21)22-2/h8-10,12H,3-7,11H2,2H3 |
| InChIKey | IINWMZAVBSOLPU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 48.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|