C21H19N3O3 — CID 71461181
1-hydroxy-6-[1-(2-methoxyethyl)pyrrolo[2,3-b]pyridin-5-yl]-4-phenylpyridin-2-one (PubChem CID 71461181) has the molecular formula C21H19N3O3 and a molecular weight of 361.40 g/mol. Its IUPAC name is 1-hydroxy-6-[1-(2-methoxyethyl)pyrrolo[2,3-b]pyridin-5-yl]-4-phenylpyridin-2-one.
| Compound Name | 1-hydroxy-6-[1-(2-methoxyethyl)pyrrolo[2,3-b]pyridin-5-yl]-4-phenylpyridin-2-one |
|---|---|
| PubChem CID | 71461181 |
| Molecular Formula | C21H19N3O3 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 1-hydroxy-6-[1-(2-methoxyethyl)pyrrolo[2,3-b]pyridin-5-yl]-4-phenylpyridin-2-one |
| SMILES | COCCn1ccc2cc(-c3cc(-c4ccccc4)cc(=O)n3O)cnc21 |
| InChI | InChI=1S/C21H19N3O3/c1-27-10-9-23-8-7-16-11-18(14-22-21(16)23)19-12-17(13-20(25)24(19)26)15-5-3-2-4-6-15/h2-8,11-14,26H,9-10H2,1H3 |
| InChIKey | UDERDBUIILFLCF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|