C25H35Cl2N9OS — CID 58830182
1-[[3-amino-6-chloro-5-[(3S)-4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]pyrazine-2-carbonyl]amino]-3-methylthiourea (PubChem CID 58830182) has the molecular formula C25H35Cl2N9OS and a molecular weight of 580.59 g/mol. Its IUPAC name is 1-[[3-amino-6-chloro-5-[(3S)-4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]pyrazine-2-carbonyl]amino]-3-methylthiourea.
| Compound Name | 1-[[3-amino-6-chloro-5-[(3S)-4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]pyrazine-2-carbonyl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 58830182 |
| Molecular Formula | C25H35Cl2N9OS |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 1-[[3-amino-6-chloro-5-[(3S)-4-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]pyrazine-2-carbonyl]amino]-3-methylthiourea |
| SMILES | CC[C@H]1CN(c2nc(N)c(C(=O)NNC(=S)NC)nc2Cl)CCN1C1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H35Cl2N9OS/c1-3-18-15-35(23-21(27)30-20(22(28)31-23)24(37)32-33-25(38)29-2)12-13-36(18)19-8-10-34(11-9-19)14-16-4-6-17(26)7-5-16/h4-7,18-19H,3,8-15H2,1-2H3,(H2,28,31)(H,32,37)(H2,29,33,38)/t18-/m0/s1 |
| InChIKey | QGKCESUXVJHZGY-SFHVURJKSA-N |
| XLogP | 2.67 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|