C28H35ClN8O — CID 88978274
3-amino-6-chloro-N-(2-cyanoethyl)-5-[(3S)-3-ethyl-4-[1-[(4-ethynylphenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyrazine-2-carboxamide (PubChem CID 88978274) has the molecular formula C28H35ClN8O and a molecular weight of 535.10 g/mol. Its IUPAC name is 3-amino-6-chloro-N-(2-cyanoethyl)-5-[(3S)-3-ethyl-4-[1-[(4-ethynylphenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-(2-cyanoethyl)-5-[(3S)-3-ethyl-4-[1-[(4-ethynylphenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 88978274 |
| Molecular Formula | C28H35ClN8O |
| Molecular Weight | 535.10 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 3-amino-6-chloro-N-(2-cyanoethyl)-5-[(3S)-3-ethyl-4-[1-[(4-ethynylphenyl)methyl]piperidin-4-yl]piperazin-1-yl]pyrazine-2-carboxamide |
| SMILES | C#Cc1ccc(CN2CCC(N3CCN(c4nc(N)c(C(=O)NCCC#N)nc4Cl)C[C@@H]3CC)CC2)cc1 |
| InChI | InChI=1S/C28H35ClN8O/c1-3-20-6-8-21(9-7-20)18-35-14-10-23(11-15-35)37-17-16-36(19-22(37)4-2)27-25(29)33-24(26(31)34-27)28(38)32-13-5-12-30/h1,6-9,22-23H,4-5,10-11,13-19H2,2H3,(H2,31,34)(H,32,38)/t22-/m0/s1 |
| InChIKey | SHYGRTZDYMVLIO-QFIPXVFZSA-N |
| XLogP | 2.90 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.10 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|