C13H21NS — CID 58833736
N-[(5S,7R)-3-methyl-1-adamantyl]ethanethioamide (PubChem CID 58833736) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is N-[(5S,7R)-3-methyl-1-adamantyl]ethanethioamide.
| Compound Name | N-[(5S,7R)-3-methyl-1-adamantyl]ethanethioamide |
|---|---|
| PubChem CID | 58833736 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-[(5S,7R)-3-methyl-1-adamantyl]ethanethioamide |
| SMILES | CC(=S)NC12C[C@@H]3C[C@@H](CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C13H21NS/c1-9(15)14-13-6-10-3-11(7-13)5-12(2,4-10)8-13/h10-11H,3-8H2,1-2H3,(H,14,15)/t10-,11+,12?,13? |
| InChIKey | LCMXZCOIJUVPON-MPEURRAXSA-N |
| XLogP | 3.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|