C15H29NS — CID 130390584
N-[1,3,3-trimethyl-5-(2-methylpropyl)cyclohexyl]ethanethioamide (PubChem CID 130390584) has the molecular formula C15H29NS and a molecular weight of 255.47 g/mol. Its IUPAC name is N-[1,3,3-trimethyl-5-(2-methylpropyl)cyclohexyl]ethanethioamide.
| Compound Name | N-[1,3,3-trimethyl-5-(2-methylpropyl)cyclohexyl]ethanethioamide |
|---|---|
| PubChem CID | 130390584 |
| Molecular Formula | C15H29NS |
| Molecular Weight | 255.47 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | N-[1,3,3-trimethyl-5-(2-methylpropyl)cyclohexyl]ethanethioamide |
| SMILES | CC(=S)NC1(C)CC(CC(C)C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H29NS/c1-11(2)7-13-8-14(4,5)10-15(6,9-13)16-12(3)17/h11,13H,7-10H2,1-6H3,(H,16,17) |
| InChIKey | WPEDYXHZVVDTHZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|