C25H37BrN2O3 — CID 58835354
4-[bromo-[1-[3-(oxan-2-yloxy)propyl]piperidin-4-ylidene]methyl]-N,N-diethylbenzamide (PubChem CID 58835354) has the molecular formula C25H37BrN2O3 and a molecular weight of 493.49 g/mol. Its IUPAC name is 4-[bromo-[1-[3-(oxan-2-yloxy)propyl]piperidin-4-ylidene]methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[bromo-[1-[3-(oxan-2-yloxy)propyl]piperidin-4-ylidene]methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 58835354 |
| Molecular Formula | C25H37BrN2O3 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 4-[bromo-[1-[3-(oxan-2-yloxy)propyl]piperidin-4-ylidene]methyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(C(Br)=C2CCN(CCCOC3CCCCO3)CC2)cc1 |
| InChI | InChI=1S/C25H37BrN2O3/c1-3-28(4-2)25(29)22-11-9-20(10-12-22)24(26)21-13-16-27(17-14-21)15-7-19-31-23-8-5-6-18-30-23/h9-12,23H,3-8,13-19H2,1-2H3 |
| InChIKey | MXAOICUSYYHNNG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|